![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Anna Magdalena/ | 2021-10-07 15:03 | - | |
| Believer/ | 2021-10-07 15:03 | - | |
| Breathless/ | 2021-10-07 15:03 | - | |
| Chelsia My Love/ | 2021-10-07 15:04 | - | |
| Comfort Women Trilogy/ | 2021-10-07 15:04 | - | |
| Concrete Clouds/ | 2021-10-07 15:04 | - | |
| DUMPLINGS/ | 2021-10-07 15:04 | - | |
| Decision to Leave/ | 2022-06-16 17:45 | - | |
| Drug War/ | 2021-10-07 15:04 | - | |
| Five Fingers of Death/ | 2021-10-07 15:04 | - | |
| Floating Landscape/ | 2021-10-07 15:04 | - | |
| Fourth Place/ | 2021-10-07 15:04 | - | |
| Like A Virgin/ | 2021-10-07 15:04 | - | |
| Perfect Life/ | 2021-10-07 15:04 | - | |
| Public Toilet/ | 2021-10-07 15:04 | - | |
| Rolling Home With A ..> | 2021-10-07 15:04 | - | |
| THE KING OF PIGS_Sti..> | 2021-10-07 15:04 | - | |
| The Bacchus Lady/ | 2021-10-07 15:04 | - | |
| The Journals of Musan/ | 2021-10-07 15:04 | - | |
| Thirst/ | 2021-10-07 15:04 | - | |
| Too Many Ways To Be ..> | 2021-10-07 15:04 | - | |